What is the molecule for caffeine?
What is the molecule for caffeine?
GENERAL
Systematic name | 1,3,7-trimethyl-1H-purine-2,6(3H,7H)-dione |
---|---|
Molecular formula | C8H10N4O2 |
SMILES | O=C1C2=C(N=CN2C)N(C(=O)N1C)C |
Molar mass | 194.19 g/mol |
Appearance | Odorless, white needles or powder |
What does caffeine do on a molecular level?
On the chemical level, caffeine is structurally similar to adenosine, a chemical that makes us sleepy. When we drink coffee, caffeine binds to our brain’s adenosine receptors, preventing the chemical from binding with the receptors and making us tired.
Why is the caffeine molecule important?
The molecule was first isolated by the German chemist Friedrich Ferdinand Runge in 1819. In plants, caffeine acts as a natural pesticide. It paralyzes and kills insects that attempt to feed on the plants. Caffeine also limits germination of seeds near the plant that could grow to compete for resources.
What is caffeine chemically made of?
The chemical is also known as caffeine, theine, mateine, guaranine, or methyltheobromine. Its chemical formula is C8 H10 N4 O2. This means it is made of 8 carbon atoms, 10 hydrogen atoms, 4 nitrogen atoms, and 2 oxygen atoms. A full and skeletal formula for caffeine is displayed below.
How does caffeine work biochemistry?
Caffeine increases intracellular concentrations of cyclic adenosine monophosphate (cAMP) by inhibiting phosphodiesterase enzymes in skeletal muscle and adipose tissues. These actions promote lipolysis via the activation of hormone-sensitive lipases with the release of free fatty acids and glycerol.
How does caffeine work in the body?
Caffeine works by stimulating the central nervous system, heart, muscles, and the centers that control blood pressure. Caffeine can raise blood pressure, but might not have this effect in people who use it all the time. Caffeine can also act like a “water pill” that increases urine flow.
What is the mechanism of action of caffeine?
Caffeine action is thought to be mediated via several mechanisms: the antagonism of adenosine receptors, the inhibition of phosphodiesterase, the release of calcium from intracellular stores, and antagonism of benzodiazepine receptors (Myers et al., 1999).
What does caffeine do biologically?
Caffeine is a stimulant, which means it increases activity in your brain and nervous system. It also increases the circulation of chemicals such as cortisol and adrenaline in the body. In small doses, caffeine can make you feel refreshed and focused.
Is caffeine an organic molecule?
caffeine, nitrogenous organic compound of the alkaloid group, substances that have marked physiological effects.
How does the body process caffeine?
After perking you up, caffeine is ultimately broken down (metabolized) by the liver into three major metabolites: paraxanthine (84%), theobromine (12%), and theophylline (4%); all three of which are also active ingredients. After the liver metabolizes caffeine, the kidneys excrete what’s remaining into urine.
What does caffeine do to the brain?
Caffeine acts as a central nervous system stimulant. When it reaches your brain, the most noticeable effect is alertness. You’ll feel more awake and less tired, so it’s a common ingredient in medications to treat or manage drowsiness, headaches, and migraines.
How does caffeine give you energy?
Boosts energy levels This is because caffeine blocks the receptors of a neurotransmitter called adenosine, and this increases levels of other neurotransmitters in your brain that regulate your energy levels, including dopamine ( 2 , 3 ).